C12H11F11O3 — CID 139680979
[3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexyl] 2-(methoxymethyl)prop-2-enoate (PubChem CID 139680979) has the molecular formula C12H11F11O3 and a molecular weight of 412.20 g/mol. Its IUPAC name is [3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexyl] 2-(methoxymethyl)prop-2-enoate.
| Compound Name | [3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexyl] 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 139680979 |
| Molecular Formula | C12H11F11O3 |
| Molecular Weight | 412.20 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | [3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexyl] 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(COC)C(=O)OCCC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H11F11O3/c1-6(5-25-2)7(24)26-4-3-8(13,14)10(16,17)9(15,11(18,19)20)12(21,22)23/h1,3-5H2,2H3 |
| InChIKey | KTIUDNFGKQJCPZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.20 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|