C19H29N5 — CID 139683390
9-methyl-2,4-dipyrrolidin-1-yl-1,2,3,4,5,6-hexahydropyrimido[4,5-b]indole (PubChem CID 139683390) has the molecular formula C19H29N5 and a molecular weight of 327.48 g/mol. Its IUPAC name is 9-methyl-2,4-dipyrrolidin-1-yl-1,2,3,4,5,6-hexahydropyrimido[4,5-b]indole.
| Compound Name | 9-methyl-2,4-dipyrrolidin-1-yl-1,2,3,4,5,6-hexahydropyrimido[4,5-b]indole |
|---|---|
| PubChem CID | 139683390 |
| Molecular Formula | C19H29N5 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | 9-methyl-2,4-dipyrrolidin-1-yl-1,2,3,4,5,6-hexahydropyrimido[4,5-b]indole |
| SMILES | Cn1c2c(c3c1NC(N1CCCC1)NC3N1CCCC1)CCC=C2 |
| InChI | InChI=1S/C19H29N5/c1-22-15-9-3-2-8-14(15)16-17(22)20-19(24-12-6-7-13-24)21-18(16)23-10-4-5-11-23/h3,9,18-21H,2,4-8,10-13H2,1H3 |
| InChIKey | IDFZQPTXBPUKLB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 35.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |