C14H20N2O6 — CID 139708141
[4-(methoxymethoxy)-1-[(4-nitrophenyl)methoxy]pyrrolidin-2-yl]methanol (PubChem CID 139708141) has the molecular formula C14H20N2O6 and a molecular weight of 312.32 g/mol. Its IUPAC name is [4-(methoxymethoxy)-1-[(4-nitrophenyl)methoxy]pyrrolidin-2-yl]methanol.
| Compound Name | [4-(methoxymethoxy)-1-[(4-nitrophenyl)methoxy]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 139708141 |
| Molecular Formula | C14H20N2O6 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | [4-(methoxymethoxy)-1-[(4-nitrophenyl)methoxy]pyrrolidin-2-yl]methanol |
| SMILES | COCOC1CC(CO)N(OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C14H20N2O6/c1-20-10-21-14-6-13(8-17)15(7-14)22-9-11-2-4-12(5-3-11)16(18)19/h2-5,13-14,17H,6-10H2,1H3 |
| InChIKey | WQAXHJFBVGQGDN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|