C15H20N2O7 — CID 139708132
[5-(hydroxymethyl)-1-[(4-nitrophenyl)methoxy]pyrrolidin-3-yl] 2-methoxyacetate (PubChem CID 139708132) has the molecular formula C15H20N2O7 and a molecular weight of 340.33 g/mol. Its IUPAC name is [5-(hydroxymethyl)-1-[(4-nitrophenyl)methoxy]pyrrolidin-3-yl] 2-methoxyacetate.
| Compound Name | [5-(hydroxymethyl)-1-[(4-nitrophenyl)methoxy]pyrrolidin-3-yl] 2-methoxyacetate |
|---|---|
| PubChem CID | 139708132 |
| Molecular Formula | C15H20N2O7 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | [5-(hydroxymethyl)-1-[(4-nitrophenyl)methoxy]pyrrolidin-3-yl] 2-methoxyacetate |
| SMILES | COCC(=O)OC1CC(CO)N(OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C15H20N2O7/c1-22-10-15(19)24-14-6-13(8-18)16(7-14)23-9-11-2-4-12(5-3-11)17(20)21/h2-5,13-14,18H,6-10H2,1H3 |
| InChIKey | WSSPIJKNJIQWOL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|