C23H24N2O3S — CID 139716006
5-[[4-[3-(5-methyl-5-phenyl-2H-1,3-oxazol-4-yl)propyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 139716006) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is 5-[[4-[3-(5-methyl-5-phenyl-2H-1,3-oxazol-4-yl)propyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[3-(5-methyl-5-phenyl-2H-1,3-oxazol-4-yl)propyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139716006 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 5-[[4-[3-(5-methyl-5-phenyl-2H-1,3-oxazol-4-yl)propyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC1(c2ccccc2)OCN=C1CCCc1ccc(CC2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C23H24N2O3S/c1-23(18-7-3-2-4-8-18)20(24-15-28-23)9-5-6-16-10-12-17(13-11-16)14-19-21(26)25-22(27)29-19/h2-4,7-8,10-13,19H,5-6,9,14-15H2,1H3,(H,25,26,27) |
| InChIKey | AIZQGHOWMQCANC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|