C9H17NSi — CID 139716381
(3,4-dimethyl-1H-pyrrol-2-yl)-trimethylsilane (PubChem CID 139716381) has the molecular formula C9H17NSi and a molecular weight of 167.33 g/mol. Its IUPAC name is (3,4-dimethyl-1H-pyrrol-2-yl)-trimethylsilane.
| Compound Name | (3,4-dimethyl-1H-pyrrol-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 139716381 |
| Molecular Formula | C9H17NSi |
| Molecular Weight | 167.33 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | (3,4-dimethyl-1H-pyrrol-2-yl)-trimethylsilane |
| SMILES | Cc1c[nH]c([Si](C)(C)C)c1C |
| InChI | InChI=1S/C9H17NSi/c1-7-6-10-9(8(7)2)11(3,4)5/h6,10H,1-5H3 |
| InChIKey | GGIXJTRENPLGBH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|