C12H12Br2N4O — CID 139721044
1-methyl-6-pyridin-2-yl-7H-imidazo[1,2-a]pyrazin-1-ium-8-one;bromide;hydrobromide (PubChem CID 139721044) has the molecular formula C12H12Br2N4O and a molecular weight of 388.06 g/mol. Its IUPAC name is 1-methyl-6-pyridin-2-yl-7H-imidazo[1,2-a]pyrazin-1-ium-8-one;bromide;hydrobromide.
| Compound Name | 1-methyl-6-pyridin-2-yl-7H-imidazo[1,2-a]pyrazin-1-ium-8-one;bromide;hydrobromide |
|---|---|
| PubChem CID | 139721044 |
| Molecular Formula | C12H12Br2N4O |
| Molecular Weight | 388.06 g/mol |
| Exact Mass | 385.94 |
| IUPAC Name | 1-methyl-6-pyridin-2-yl-7H-imidazo[1,2-a]pyrazin-1-ium-8-one;bromide;hydrobromide |
| SMILES | Br.C[n+]1ccn2cc(-c3ccccn3)[nH]c(=O)c21.[Br-] |
| InChI | InChI=1S/C12H10N4O.2BrH/c1-15-6-7-16-8-10(14-11(17)12(15)16)9-4-2-3-5-13-9;;/h2-8H,1H3;2*1H |
| InChIKey | HDAPCCNZKSACMD-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.06 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|