About tris(2-hydroxyphenyl) arsorite
tris(2-hydroxyphenyl) arsorite (PubChem CID 139727037) has the molecular formula C18H15AsO6
and a molecular weight of 402.23 g/mol. Its IUPAC name is tris(2-hydroxyphenyl) arsorite.
Molecular Properties
| Compound Name | tris(2-hydroxyphenyl) arsorite |
| PubChem CID | 139727037 |
| Molecular Formula | C18H15AsO6 |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | tris(2-hydroxyphenyl) arsorite |
| SMILES | Oc1ccccc1O[As](Oc1ccccc1O)Oc1ccccc1O |
| InChI | InChI=1S/C18H15AsO6/c20-13-7-1-4-10-16(13)23-19(24-17-11-5-2-8-14(17)21)25-18-12-6-3-9-15(18)22/h1-12,20-22H |
| InChIKey | IDSDSYGHADIVIH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tris(2-hydroxyphenyl) arsorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2-hydroxyphenyl) arsorite?
The IUPAC name of tris(2-hydroxyphenyl) arsorite (CID 139727037) is tris(2-hydroxyphenyl) arsorite.
What is the SMILES notation for tris(2-hydroxyphenyl) arsorite?
The canonical SMILES for tris(2-hydroxyphenyl) arsorite is Oc1ccccc1O[As](Oc1ccccc1O)Oc1ccccc1O.
What is the InChIKey of tris(2-hydroxyphenyl) arsorite?
The InChIKey is IDSDSYGHADIVIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15AsO6/c20-13-7-1-4-10-16(13)23-19(24-17-11-5-2-8-14(17)21)25-18-12-6-3-9-15(18)22/h1-12,20-22H.
What are the key properties of tris(2-hydroxyphenyl) arsorite?
tris(2-hydroxyphenyl) arsorite has a molecular weight of 402.23 g/mol, XLogP of 3.33, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2-hydroxyphenyl) arsorite is sourced from PubChem (CID 139727037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).