C8H12N2O4 — CID 139748440
(methoxymethylidenecarbamoylamino)methyl 2-methylprop-2-enoate (PubChem CID 139748440) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is (methoxymethylidenecarbamoylamino)methyl 2-methylprop-2-enoate.
| Compound Name | (methoxymethylidenecarbamoylamino)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139748440 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | (methoxymethylidenecarbamoylamino)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCNC(=O)N=COC |
| InChI | InChI=1S/C8H12N2O4/c1-6(2)7(11)14-5-10-8(12)9-4-13-3/h4H,1,5H2,2-3H3,(H,10,12) |
| InChIKey | IOEQRBDRVOSLMT-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|