C8H13N3O6 — CID 174511243
[(3-amino-3-oxopropanoyl)amino]methyl 2-methylprop-2-enoate;nitrous acid (PubChem CID 174511243) has the molecular formula C8H13N3O6 and a molecular weight of 247.21 g/mol. Its IUPAC name is [(3-amino-3-oxopropanoyl)amino]methyl 2-methylprop-2-enoate;nitrous acid.
| Compound Name | [(3-amino-3-oxopropanoyl)amino]methyl 2-methylprop-2-enoate;nitrous acid |
|---|---|
| PubChem CID | 174511243 |
| Molecular Formula | C8H13N3O6 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | [(3-amino-3-oxopropanoyl)amino]methyl 2-methylprop-2-enoate;nitrous acid |
| SMILES | C=C(C)C(=O)OCNC(=O)CC(N)=O.O=NO |
| InChI | InChI=1S/C8H12N2O4.HNO2/c1-5(2)8(13)14-4-10-7(12)3-6(9)11;2-1-3/h1,3-4H2,2H3,(H2,9,11)(H,10,12);(H,2,3) |
| InChIKey | RZMMGOBPYPPWIJ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 148.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|