C14H32AlNO — CID 139756116
2-[bis(2-methylpropyl)alumanyloxy]-N,N-diethylethanamine (PubChem CID 139756116) has the molecular formula C14H32AlNO and a molecular weight of 257.40 g/mol. Its IUPAC name is 2-[bis(2-methylpropyl)alumanyloxy]-N,N-diethylethanamine.
| Compound Name | 2-[bis(2-methylpropyl)alumanyloxy]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 139756116 |
| Molecular Formula | C14H32AlNO |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.23 |
| IUPAC Name | 2-[bis(2-methylpropyl)alumanyloxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCO[Al](CC(C)C)CC(C)C |
| InChI | InChI=1S/C6H14NO.2C4H9.Al/c1-3-7(4-2)5-6-8;2*1-4(2)3;/h3-6H2,1-2H3;2*4H,1H2,2-3H3;/q-1;;;+1 |
| InChIKey | QMPLFAZPFWBJOR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |