C33H41FO6 — CID 139759658
[3-fluoro-4-[(2R)-octan-2-yl]oxyphenyl] (1S)-4-phenyl-1-(2-propoxypropanoyloxy)cyclohexa-2,4-diene-1-carboxylate (PubChem CID 139759658) has the molecular formula C33H41FO6 and a molecular weight of 552.68 g/mol. Its IUPAC name is [3-fluoro-4-[(2R)-octan-2-yl]oxyphenyl] (1S)-4-phenyl-1-(2-propoxypropanoyloxy)cyclohexa-2,4-diene-1-carboxylate.
| Compound Name | [3-fluoro-4-[(2R)-octan-2-yl]oxyphenyl] (1S)-4-phenyl-1-(2-propoxypropanoyloxy)cyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 139759658 |
| Molecular Formula | C33H41FO6 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | [3-fluoro-4-[(2R)-octan-2-yl]oxyphenyl] (1S)-4-phenyl-1-(2-propoxypropanoyloxy)cyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCCCCC[C@@H](C)Oc1ccc(OC(=O)[C@@]2(OC(=O)C(C)OCCC)C=CC(c3ccccc3)=CC2)cc1F |
| InChI | InChI=1S/C33H41FO6/c1-5-7-8-10-13-24(3)38-30-17-16-28(23-29(30)34)39-32(36)33(40-31(35)25(4)37-22-6-2)20-18-27(19-21-33)26-14-11-9-12-15-26/h9,11-12,14-20,23-25H,5-8,10,13,21-22H2,1-4H3/t24-,25?,33-/m1/s1 |
| InChIKey | KLBKYCFDKCPHTI-AFHXBMDUSA-N |
| XLogP | 7.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|