C16H20N2O6 — CID 139764566
3-[2-(2,5-dioxo-4-propylpyrrol-3-yl)oxyethoxy]-4-propylpyrrole-2,5-dione (PubChem CID 139764566) has the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. Its IUPAC name is 3-[2-(2,5-dioxo-4-propylpyrrol-3-yl)oxyethoxy]-4-propylpyrrole-2,5-dione.
| Compound Name | 3-[2-(2,5-dioxo-4-propylpyrrol-3-yl)oxyethoxy]-4-propylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 139764566 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 3-[2-(2,5-dioxo-4-propylpyrrol-3-yl)oxyethoxy]-4-propylpyrrole-2,5-dione |
| SMILES | CCCC1=C(OCCOC2=C(CCC)C(=O)NC2=O)C(=O)NC1=O |
| InChI | InChI=1S/C16H20N2O6/c1-3-5-9-11(15(21)17-13(9)19)23-7-8-24-12-10(6-4-2)14(20)18-16(12)22/h3-8H2,1-2H3,(H,17,19,21)(H,18,20,22) |
| InChIKey | KDHKLVOIFNMOLZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|