C19H26N2O — CID 139770454
3-(4,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl)-N,N-diethyl-1,2-oxazol-4-amine (PubChem CID 139770454) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 3-(4,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl)-N,N-diethyl-1,2-oxazol-4-amine.
| Compound Name | 3-(4,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl)-N,N-diethyl-1,2-oxazol-4-amine |
|---|---|
| PubChem CID | 139770454 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 3-(4,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl)-N,N-diethyl-1,2-oxazol-4-amine |
| SMILES | CCN(CC)c1conc1C1Cc2cc(C)ccc2C(C)C1 |
| InChI | InChI=1S/C19H26N2O/c1-5-21(6-2)18-12-22-20-19(18)16-10-14(4)17-8-7-13(3)9-15(17)11-16/h7-9,12,14,16H,5-6,10-11H2,1-4H3 |
| InChIKey | MSRBMJAXZXFOGX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |