C16H20N2O — CID 139770682
3-(2,3-dihydro-1H-inden-2-yl)-N,N-diethyl-1,2-oxazol-4-amine (PubChem CID 139770682) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-2-yl)-N,N-diethyl-1,2-oxazol-4-amine.
| Compound Name | 3-(2,3-dihydro-1H-inden-2-yl)-N,N-diethyl-1,2-oxazol-4-amine |
|---|---|
| PubChem CID | 139770682 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-2-yl)-N,N-diethyl-1,2-oxazol-4-amine |
| SMILES | CCN(CC)c1conc1C1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H20N2O/c1-3-18(4-2)15-11-19-17-16(15)14-9-12-7-5-6-8-13(12)10-14/h5-8,11,14H,3-4,9-10H2,1-2H3 |
| InChIKey | IMBWKLMZQKWIOK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |