C18H17BrO4S — CID 139771454
4-(5-bromo-5-methylcyclohexa-1,3-dien-1-yl)-3-(4-methylsulfonylphenyl)-2H-furan-5-one (PubChem CID 139771454) has the molecular formula C18H17BrO4S and a molecular weight of 409.30 g/mol. Its IUPAC name is 4-(5-bromo-5-methylcyclohexa-1,3-dien-1-yl)-3-(4-methylsulfonylphenyl)-2H-furan-5-one.
| Compound Name | 4-(5-bromo-5-methylcyclohexa-1,3-dien-1-yl)-3-(4-methylsulfonylphenyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 139771454 |
| Molecular Formula | C18H17BrO4S |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | 4-(5-bromo-5-methylcyclohexa-1,3-dien-1-yl)-3-(4-methylsulfonylphenyl)-2H-furan-5-one |
| SMILES | CC1(Br)C=CC=C(C2=C(c3ccc(S(C)(=O)=O)cc3)COC2=O)C1 |
| InChI | InChI=1S/C18H17BrO4S/c1-18(19)9-3-4-13(10-18)16-15(11-23-17(16)20)12-5-7-14(8-6-12)24(2,21)22/h3-9H,10-11H2,1-2H3 |
| InChIKey | NRKOOETYAYCFFA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|