C23H20FN5OS — CID 139773531
2-[2-[2-fluoro-3-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]phenyl]ethynyl]-4-propan-2-yl-1,3-thiazole (PubChem CID 139773531) has the molecular formula C23H20FN5OS and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-[2-[2-fluoro-3-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]phenyl]ethynyl]-4-propan-2-yl-1,3-thiazole.
| Compound Name | 2-[2-[2-fluoro-3-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]phenyl]ethynyl]-4-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 139773531 |
| Molecular Formula | C23H20FN5OS |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 2-[2-[2-fluoro-3-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]phenyl]ethynyl]-4-propan-2-yl-1,3-thiazole |
| SMILES | COc1ccc(Cn2nnc(-c3cccc(C#Cc4nc(C(C)C)cs4)c3F)n2)cc1 |
| InChI | InChI=1S/C23H20FN5OS/c1-15(2)20-14-31-21(25-20)12-9-17-5-4-6-19(22(17)24)23-26-28-29(27-23)13-16-7-10-18(30-3)11-8-16/h4-8,10-11,14-15H,13H2,1-3H3 |
| InChIKey | HSOMNEJDUUMXGS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|