C24H22N6OS — CID 139774002
N-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]-2-[(4-methoxyphenyl)methyl]tetrazol-5-amine (PubChem CID 139774002) has the molecular formula C24H22N6OS and a molecular weight of 442.55 g/mol. Its IUPAC name is N-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]-2-[(4-methoxyphenyl)methyl]tetrazol-5-amine.
| Compound Name | N-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]-2-[(4-methoxyphenyl)methyl]tetrazol-5-amine |
|---|---|
| PubChem CID | 139774002 |
| Molecular Formula | C24H22N6OS |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | N-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]-2-[(4-methoxyphenyl)methyl]tetrazol-5-amine |
| SMILES | COc1ccc(Cn2nnc(Nc3cccc(C#Cc4nc(C5CCC5)cs4)c3)n2)cc1 |
| InChI | InChI=1S/C24H22N6OS/c1-31-21-11-8-18(9-12-21)15-30-28-24(27-29-30)25-20-7-2-4-17(14-20)10-13-23-26-22(16-32-23)19-5-3-6-19/h2,4,7-9,11-12,14,16,19H,3,5-6,15H2,1H3,(H,25,28) |
| InChIKey | DIXPGNBVSVRGOP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|