C25H21N3O3S — CID 139773867
5-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]-2-[(4-methoxyphenyl)methyl]-1,2,4-oxadiazol-3-one (PubChem CID 139773867) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is 5-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]-2-[(4-methoxyphenyl)methyl]-1,2,4-oxadiazol-3-one.
| Compound Name | 5-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]-2-[(4-methoxyphenyl)methyl]-1,2,4-oxadiazol-3-one |
|---|---|
| PubChem CID | 139773867 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 5-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]-2-[(4-methoxyphenyl)methyl]-1,2,4-oxadiazol-3-one |
| SMILES | COc1ccc(Cn2oc(-c3cccc(C#Cc4nc(C5CCC5)cs4)c3)nc2=O)cc1 |
| InChI | InChI=1S/C25H21N3O3S/c1-30-21-11-8-18(9-12-21)15-28-25(29)27-24(31-28)20-7-2-4-17(14-20)10-13-23-26-22(16-32-23)19-5-3-6-19/h2,4,7-9,11-12,14,16,19H,3,5-6,15H2,1H3 |
| InChIKey | OTIKSKLZZMVQBQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|