C24H19ClN6OS — CID 139773546
5-chloro-N-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]-2-methyl-4-(2H-tetrazol-5-yl)benzamide (PubChem CID 139773546) has the molecular formula C24H19ClN6OS and a molecular weight of 474.98 g/mol. Its IUPAC name is 5-chloro-N-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]-2-methyl-4-(2H-tetrazol-5-yl)benzamide.
| Compound Name | 5-chloro-N-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]-2-methyl-4-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 139773546 |
| Molecular Formula | C24H19ClN6OS |
| Molecular Weight | 474.98 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 5-chloro-N-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]-2-methyl-4-(2H-tetrazol-5-yl)benzamide |
| SMILES | Cc1cc(-c2nn[nH]n2)c(Cl)cc1C(=O)Nc1cccc(C#Cc2nc(C3CCC3)cs2)c1 |
| InChI | InChI=1S/C24H19ClN6OS/c1-14-10-19(23-28-30-31-29-23)20(25)12-18(14)24(32)26-17-7-2-4-15(11-17)8-9-22-27-21(13-33-22)16-5-3-6-16/h2,4,7,10-13,16H,3,5-6H2,1H3,(H,26,32)(H,28,29,30,31) |
| InChIKey | SGFYCEBHRBRNGZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.98 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|