C23H18N6OS — CID 139773649
3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide (PubChem CID 139773649) has the molecular formula C23H18N6OS and a molecular weight of 426.51 g/mol. Its IUPAC name is 3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide.
| Compound Name | 3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 139773649 |
| Molecular Formula | C23H18N6OS |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-N-[3-(2H-tetrazol-5-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2nn[nH]n2)c1)c1cccc(C#Cc2nc(C3CCC3)cs2)c1 |
| InChI | InChI=1S/C23H18N6OS/c30-23(24-19-9-3-7-17(13-19)22-26-28-29-27-22)18-8-1-4-15(12-18)10-11-21-25-20(14-31-21)16-5-2-6-16/h1,3-4,7-9,12-14,16H,2,5-6H2,(H,24,30)(H,26,27,28,29) |
| InChIKey | SEEPXHONYIHIDV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|