C24H20N6O2S — CID 139773937
3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-N-[2-methoxy-4-(2H-tetrazol-5-yl)phenyl]benzamide (PubChem CID 139773937) has the molecular formula C24H20N6O2S and a molecular weight of 456.53 g/mol. Its IUPAC name is 3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-N-[2-methoxy-4-(2H-tetrazol-5-yl)phenyl]benzamide.
| Compound Name | 3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-N-[2-methoxy-4-(2H-tetrazol-5-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 139773937 |
| Molecular Formula | C24H20N6O2S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-N-[2-methoxy-4-(2H-tetrazol-5-yl)phenyl]benzamide |
| SMILES | COc1cc(-c2nn[nH]n2)ccc1NC(=O)c1cccc(C#Cc2nc(C3CCC3)cs2)c1 |
| InChI | InChI=1S/C24H20N6O2S/c1-32-21-13-17(23-27-29-30-28-23)9-10-19(21)26-24(31)18-7-2-4-15(12-18)8-11-22-25-20(14-33-22)16-5-3-6-16/h2,4,7,9-10,12-14,16H,3,5-6H2,1H3,(H,26,31)(H,27,28,29,30) |
| InChIKey | SAJZDADVEPMWTP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|