C16H15N5S — CID 139773922
4-tert-butyl-2-[2-[3-(2H-tetrazol-5-yl)phenyl]ethynyl]-1,3-thiazole (PubChem CID 139773922) has the molecular formula C16H15N5S and a molecular weight of 309.40 g/mol. Its IUPAC name is 4-tert-butyl-2-[2-[3-(2H-tetrazol-5-yl)phenyl]ethynyl]-1,3-thiazole.
| Compound Name | 4-tert-butyl-2-[2-[3-(2H-tetrazol-5-yl)phenyl]ethynyl]-1,3-thiazole |
|---|---|
| PubChem CID | 139773922 |
| Molecular Formula | C16H15N5S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 4-tert-butyl-2-[2-[3-(2H-tetrazol-5-yl)phenyl]ethynyl]-1,3-thiazole |
| SMILES | CC(C)(C)c1csc(C#Cc2cccc(-c3nn[nH]n3)c2)n1 |
| InChI | InChI=1S/C16H15N5S/c1-16(2,3)13-10-22-14(17-13)8-7-11-5-4-6-12(9-11)15-18-20-21-19-15/h4-6,9-10H,1-3H3,(H,18,19,20,21) |
| InChIKey | QIPUBQVBYHPPHF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|