C15H12BrNS — CID 139773659
2-[2-(3-bromophenyl)ethynyl]-4-cyclobutyl-1,3-thiazole (PubChem CID 139773659) has the molecular formula C15H12BrNS and a molecular weight of 318.24 g/mol. Its IUPAC name is 2-[2-(3-bromophenyl)ethynyl]-4-cyclobutyl-1,3-thiazole.
| Compound Name | 2-[2-(3-bromophenyl)ethynyl]-4-cyclobutyl-1,3-thiazole |
|---|---|
| PubChem CID | 139773659 |
| Molecular Formula | C15H12BrNS |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 2-[2-(3-bromophenyl)ethynyl]-4-cyclobutyl-1,3-thiazole |
| SMILES | Brc1cccc(C#Cc2nc(C3CCC3)cs2)c1 |
| InChI | InChI=1S/C15H12BrNS/c16-13-6-1-3-11(9-13)7-8-15-17-14(10-18-15)12-4-2-5-12/h1,3,6,9-10,12H,2,4-5H2 |
| InChIKey | SKYVQRGAVRTZIL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|