C19H14N2O2S2 — CID 139773648
5-[[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 139773648) has the molecular formula C19H14N2O2S2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 5-[[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139773648 |
| Molecular Formula | C19H14N2O2S2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 5-[[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2cccc(C#Cc3nc(C4CCC4)cs3)c2)S1 |
| InChI | InChI=1S/C19H14N2O2S2/c22-18-16(25-19(23)21-18)10-13-4-1-3-12(9-13)7-8-17-20-15(11-24-17)14-5-2-6-14/h1,3-4,9-11,14H,2,5-6H2,(H,21,22,23) |
| InChIKey | BUTNESNRRGIHQD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|