C19H16N4O2S — CID 139773556
5-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]-2-methyltriazole-4-carboxylic acid (PubChem CID 139773556) has the molecular formula C19H16N4O2S and a molecular weight of 364.43 g/mol. Its IUPAC name is 5-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]-2-methyltriazole-4-carboxylic acid.
| Compound Name | 5-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]-2-methyltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 139773556 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 5-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]phenyl]-2-methyltriazole-4-carboxylic acid |
| SMILES | Cn1nc(C(=O)O)c(-c2cccc(C#Cc3nc(C4CCC4)cs3)c2)n1 |
| InChI | InChI=1S/C19H16N4O2S/c1-23-21-17(18(22-23)19(24)25)14-7-2-4-12(10-14)8-9-16-20-15(11-26-16)13-5-3-6-13/h2,4,7,10-11,13H,3,5-6H2,1H3,(H,24,25) |
| InChIKey | VHESQHYGHGXLAU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|