C26H23N5O3S — CID 139773966
methyl 3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-5-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]benzoate (PubChem CID 139773966) has the molecular formula C26H23N5O3S and a molecular weight of 485.57 g/mol. Its IUPAC name is methyl 3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-5-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]benzoate.
| Compound Name | methyl 3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-5-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]benzoate |
|---|---|
| PubChem CID | 139773966 |
| Molecular Formula | C26H23N5O3S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | methyl 3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-5-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]benzoate |
| SMILES | COC(=O)c1cc(C#Cc2nc(C3CCC3)cs2)cc(-c2nnn(Cc3ccc(OC)cc3)n2)c1 |
| InChI | InChI=1S/C26H23N5O3S/c1-33-22-9-6-17(7-10-22)15-31-29-25(28-30-31)20-12-18(13-21(14-20)26(32)34-2)8-11-24-27-23(16-35-24)19-4-3-5-19/h6-7,9-10,12-14,16,19H,3-5,15H2,1-2H3 |
| InChIKey | RSUUDRNINNJCQZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 92.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|