C23H21N5OS — CID 139773591
2-[2-[3-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]phenyl]ethynyl]-4-propyl-1,3-thiazole (PubChem CID 139773591) has the molecular formula C23H21N5OS and a molecular weight of 415.52 g/mol. Its IUPAC name is 2-[2-[3-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]phenyl]ethynyl]-4-propyl-1,3-thiazole.
| Compound Name | 2-[2-[3-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]phenyl]ethynyl]-4-propyl-1,3-thiazole |
|---|---|
| PubChem CID | 139773591 |
| Molecular Formula | C23H21N5OS |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 2-[2-[3-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]phenyl]ethynyl]-4-propyl-1,3-thiazole |
| SMILES | CCCc1csc(C#Cc2cccc(-c3nnn(Cc4ccc(OC)cc4)n3)c2)n1 |
| InChI | InChI=1S/C23H21N5OS/c1-3-5-20-16-30-22(24-20)13-10-17-6-4-7-19(14-17)23-25-27-28(26-23)15-18-8-11-21(29-2)12-9-18/h4,6-9,11-12,14,16H,3,5,15H2,1-2H3 |
| InChIKey | YBLSWPXOSYTLLE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|