C25H20N6O2S — CID 139773678
5-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-1,3-benzoxazole (PubChem CID 139773678) has the molecular formula C25H20N6O2S and a molecular weight of 468.54 g/mol. Its IUPAC name is 5-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-1,3-benzoxazole.
| Compound Name | 5-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 139773678 |
| Molecular Formula | C25H20N6O2S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 5-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-2-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-1,3-benzoxazole |
| SMILES | COc1ccc(Cn2nnc(-c3nc4cc(C#Cc5nc(C6CCC6)cs5)ccc4o3)n2)cc1 |
| InChI | InChI=1S/C25H20N6O2S/c1-32-19-9-5-17(6-10-19)14-31-29-24(28-30-31)25-27-20-13-16(7-11-22(20)33-25)8-12-23-26-21(15-34-23)18-3-2-4-18/h5-7,9-11,13,15,18H,2-4,14H2,1H3 |
| InChIKey | ZEAYCIQNLHPHET-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 91.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|