C14H11N5S2 — CID 139773895
4-cyclobutyl-2-[2-[5-(2H-tetrazol-5-yl)thiophen-2-yl]ethynyl]-1,3-thiazole (PubChem CID 139773895) has the molecular formula C14H11N5S2 and a molecular weight of 313.41 g/mol. Its IUPAC name is 4-cyclobutyl-2-[2-[5-(2H-tetrazol-5-yl)thiophen-2-yl]ethynyl]-1,3-thiazole.
| Compound Name | 4-cyclobutyl-2-[2-[5-(2H-tetrazol-5-yl)thiophen-2-yl]ethynyl]-1,3-thiazole |
|---|---|
| PubChem CID | 139773895 |
| Molecular Formula | C14H11N5S2 |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 4-cyclobutyl-2-[2-[5-(2H-tetrazol-5-yl)thiophen-2-yl]ethynyl]-1,3-thiazole |
| SMILES | C(#Cc1nc(C2CCC2)cs1)c1ccc(-c2nn[nH]n2)s1 |
| InChI | InChI=1S/C14H11N5S2/c1-2-9(3-1)11-8-20-13(15-11)7-5-10-4-6-12(21-10)14-16-18-19-17-14/h4,6,8-9H,1-3H2,(H,16,17,18,19) |
| InChIKey | PCIXGPNFEBBCFP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|