C16H12ClN5S — CID 139773729
2-[2-[2-chloro-3-(2H-tetrazol-5-yl)phenyl]ethynyl]-4-cyclobutyl-1,3-thiazole (PubChem CID 139773729) has the molecular formula C16H12ClN5S and a molecular weight of 341.83 g/mol. Its IUPAC name is 2-[2-[2-chloro-3-(2H-tetrazol-5-yl)phenyl]ethynyl]-4-cyclobutyl-1,3-thiazole.
| Compound Name | 2-[2-[2-chloro-3-(2H-tetrazol-5-yl)phenyl]ethynyl]-4-cyclobutyl-1,3-thiazole |
|---|---|
| PubChem CID | 139773729 |
| Molecular Formula | C16H12ClN5S |
| Molecular Weight | 341.83 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-[2-[2-chloro-3-(2H-tetrazol-5-yl)phenyl]ethynyl]-4-cyclobutyl-1,3-thiazole |
| SMILES | Clc1c(C#Cc2nc(C3CCC3)cs2)cccc1-c1nn[nH]n1 |
| InChI | InChI=1S/C16H12ClN5S/c17-15-11(5-2-6-12(15)16-19-21-22-20-16)7-8-14-18-13(9-23-14)10-3-1-4-10/h2,5-6,9-10H,1,3-4H2,(H,19,20,21,22) |
| InChIKey | HXZCIZQTAPAQRS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.83 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|