C19H16F4 — CID 139776694
3,4,5,6-tetrafluoro-2-pent-1-enyl-9,10-dihydrophenanthrene (PubChem CID 139776694) has the molecular formula C19H16F4 and a molecular weight of 320.33 g/mol. Its IUPAC name is 3,4,5,6-tetrafluoro-2-pent-1-enyl-9,10-dihydrophenanthrene.
| Compound Name | 3,4,5,6-tetrafluoro-2-pent-1-enyl-9,10-dihydrophenanthrene |
|---|---|
| PubChem CID | 139776694 |
| Molecular Formula | C19H16F4 |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 3,4,5,6-tetrafluoro-2-pent-1-enyl-9,10-dihydrophenanthrene |
| SMILES | CCCC=Cc1cc2c(c(F)c1F)-c1c(ccc(F)c1F)CC2 |
| InChI | InChI=1S/C19H16F4/c1-2-3-4-5-13-10-12-7-6-11-8-9-14(20)18(22)15(11)16(12)19(23)17(13)21/h4-5,8-10H,2-3,6-7H2,1H3 |
| InChIKey | AXVVXBRKIGIIPW-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |