C19H28O5 — CID 139790314
5-methoxy-2-[(E)-pent-1-enyl]-6-(phenylmethoxymethyl)oxane-2,3-diol (PubChem CID 139790314) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is 5-methoxy-2-[(E)-pent-1-enyl]-6-(phenylmethoxymethyl)oxane-2,3-diol.
| Compound Name | 5-methoxy-2-[(E)-pent-1-enyl]-6-(phenylmethoxymethyl)oxane-2,3-diol |
|---|---|
| PubChem CID | 139790314 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 5-methoxy-2-[(E)-pent-1-enyl]-6-(phenylmethoxymethyl)oxane-2,3-diol |
| SMILES | CCC/C=C/C1(O)OC(COCc2ccccc2)C(OC)CC1O |
| InChI | InChI=1S/C19H28O5/c1-3-4-8-11-19(21)18(20)12-16(22-2)17(24-19)14-23-13-15-9-6-5-7-10-15/h5-11,16-18,20-21H,3-4,12-14H2,1-2H3/b11-8+ |
| InChIKey | VOWCHYNZCZJULX-DHZHZOJOSA-N |
| XLogP | 2.41 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|