C33H51N9O12 — CID 139802254
1-[[[4,6-bis[[2-(methylamino)-2-oxoethyl]-(2-prop-2-enoyloxypropoxymethyl)amino]-1,3,5-triazin-2-yl]-[2-(methylamino)-2-oxoethyl]amino]methoxy]propan-2-yl prop-2-enoate (PubChem CID 139802254) has the molecular formula C33H51N9O12 and a molecular weight of 765.82 g/mol. Its IUPAC name is 1-[[[4,6-bis[[2-(methylamino)-2-oxoethyl]-(2-prop-2-enoyloxypropoxymethyl)amino]-1,3,5-triazin-2-yl]-[2-(methylamino)-2-oxoethyl]amino]methoxy]propan-2-yl prop-2-enoate.
| Compound Name | 1-[[[4,6-bis[[2-(methylamino)-2-oxoethyl]-(2-prop-2-enoyloxypropoxymethyl)amino]-1,3,5-triazin-2-yl]-[2-(methylamino)-2-oxoethyl]amino]methoxy]propan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 139802254 |
| Molecular Formula | C33H51N9O12 |
| Molecular Weight | 765.82 g/mol |
| Exact Mass | 765.37 |
| IUPAC Name | 1-[[[4,6-bis[[2-(methylamino)-2-oxoethyl]-(2-prop-2-enoyloxypropoxymethyl)amino]-1,3,5-triazin-2-yl]-[2-(methylamino)-2-oxoethyl]amino]methoxy]propan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)COCN(CC(=O)NC)c1nc(N(COCC(C)OC(=O)C=C)CC(=O)NC)nc(N(COCC(C)OC(=O)C=C)CC(=O)NC)n1 |
| InChI | InChI=1S/C33H51N9O12/c1-10-28(46)52-22(4)16-49-19-40(13-25(43)34-7)31-37-32(41(14-26(44)35-8)20-50-17-23(5)53-29(47)11-2)39-33(38-31)42(15-27(45)36-9)21-51-18-24(6)54-30(48)12-3/h10-12,22-24H,1-3,13-21H2,4-9H3,(H,34,43)(H,35,44)(H,36,45) |
| InChIKey | VPMYBDDQKGJKDX-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 242.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.82 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|