C20H26IN5O2 — CID 139809654
2-[[3-(benzotriazol-2-yl)-3-(4-hydroxyphenyl)propanoyl]amino]ethyl-trimethylazanium iodide (PubChem CID 139809654) has the molecular formula C20H26IN5O2 and a molecular weight of 495.37 g/mol. Its IUPAC name is 2-[[3-(benzotriazol-2-yl)-3-(4-hydroxyphenyl)propanoyl]amino]ethyl-trimethylazanium iodide.
| Compound Name | 2-[[3-(benzotriazol-2-yl)-3-(4-hydroxyphenyl)propanoyl]amino]ethyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 139809654 |
| Molecular Formula | C20H26IN5O2 |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 2-[[3-(benzotriazol-2-yl)-3-(4-hydroxyphenyl)propanoyl]amino]ethyl-trimethylazanium iodide |
| SMILES | C[N+](C)(C)CCNC(=O)CC(c1ccc(O)cc1)n1nc2ccccc2n1.[I-] |
| InChI | InChI=1S/C20H25N5O2.HI/c1-25(2,3)13-12-21-20(27)14-19(15-8-10-16(26)11-9-15)24-22-17-6-4-5-7-18(17)23-24;/h4-11,19H,12-14H2,1-3H3,(H-,21,26,27);1H |
| InChIKey | KOPDXGSPPBBHPB-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|