C26H38ClN5O2 — CID 139831212
4-[[3-(benzotriazol-2-yl)-3-(3-tert-butyl-4-hydroxyphenyl)propanoyl]amino]butyl-trimethylazanium chloride (PubChem CID 139831212) has the molecular formula C26H38ClN5O2 and a molecular weight of 488.08 g/mol. Its IUPAC name is 4-[[3-(benzotriazol-2-yl)-3-(3-tert-butyl-4-hydroxyphenyl)propanoyl]amino]butyl-trimethylazanium chloride.
| Compound Name | 4-[[3-(benzotriazol-2-yl)-3-(3-tert-butyl-4-hydroxyphenyl)propanoyl]amino]butyl-trimethylazanium chloride |
|---|---|
| PubChem CID | 139831212 |
| Molecular Formula | C26H38ClN5O2 |
| Molecular Weight | 488.08 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | 4-[[3-(benzotriazol-2-yl)-3-(3-tert-butyl-4-hydroxyphenyl)propanoyl]amino]butyl-trimethylazanium chloride |
| SMILES | CC(C)(C)c1cc(C(CC(=O)NCCCC[N+](C)(C)C)n2nc3ccccc3n2)ccc1O.[Cl-] |
| InChI | InChI=1S/C26H37N5O2.ClH/c1-26(2,3)20-17-19(13-14-24(20)32)23(30-28-21-11-7-8-12-22(21)29-30)18-25(33)27-15-9-10-16-31(4,5)6;/h7-8,11-14,17,23H,9-10,15-16,18H2,1-6H3,(H-,27,32,33);1H |
| InChIKey | YSRRXEASXMTWTK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.08 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|