C21H28ClN5O2 — CID 139809622
3-[[3-(benzotriazol-2-yl)-3-(4-hydroxyphenyl)propanoyl]amino]propyl-trimethylazanium chloride (PubChem CID 139809622) has the molecular formula C21H28ClN5O2 and a molecular weight of 417.94 g/mol. Its IUPAC name is 3-[[3-(benzotriazol-2-yl)-3-(4-hydroxyphenyl)propanoyl]amino]propyl-trimethylazanium chloride.
| Compound Name | 3-[[3-(benzotriazol-2-yl)-3-(4-hydroxyphenyl)propanoyl]amino]propyl-trimethylazanium chloride |
|---|---|
| PubChem CID | 139809622 |
| Molecular Formula | C21H28ClN5O2 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 3-[[3-(benzotriazol-2-yl)-3-(4-hydroxyphenyl)propanoyl]amino]propyl-trimethylazanium chloride |
| SMILES | C[N+](C)(C)CCCNC(=O)CC(c1ccc(O)cc1)n1nc2ccccc2n1.[Cl-] |
| InChI | InChI=1S/C21H27N5O2.ClH/c1-26(2,3)14-6-13-22-21(28)15-20(16-9-11-17(27)12-10-16)25-23-18-7-4-5-8-19(18)24-25;/h4-5,7-12,20H,6,13-15H2,1-3H3,(H-,22,27,28);1H |
| InChIKey | GBTYEGFHDWUPKT-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|