C23H33NO5 — CID 139815942
cyclopentylmethyl 2-(3-cyclopentyloxy-4-methoxyphenyl)morpholine-4-carboxylate (PubChem CID 139815942) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is cyclopentylmethyl 2-(3-cyclopentyloxy-4-methoxyphenyl)morpholine-4-carboxylate.
| Compound Name | cyclopentylmethyl 2-(3-cyclopentyloxy-4-methoxyphenyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 139815942 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | cyclopentylmethyl 2-(3-cyclopentyloxy-4-methoxyphenyl)morpholine-4-carboxylate |
| SMILES | COc1ccc(C2CN(C(=O)OCC3CCCC3)CCO2)cc1OC1CCCC1 |
| InChI | InChI=1S/C23H33NO5/c1-26-20-11-10-18(14-21(20)29-19-8-4-5-9-19)22-15-24(12-13-27-22)23(25)28-16-17-6-2-3-7-17/h10-11,14,17,19,22H,2-9,12-13,15-16H2,1H3 |
| InChIKey | CZIAZSHSGCZVDA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |