C23H28N2O5 — CID 139815952
pyridin-2-ylmethyl 2-(3-cyclopentyloxy-4-methoxyphenyl)morpholine-4-carboxylate (PubChem CID 139815952) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is pyridin-2-ylmethyl 2-(3-cyclopentyloxy-4-methoxyphenyl)morpholine-4-carboxylate.
| Compound Name | pyridin-2-ylmethyl 2-(3-cyclopentyloxy-4-methoxyphenyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 139815952 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | pyridin-2-ylmethyl 2-(3-cyclopentyloxy-4-methoxyphenyl)morpholine-4-carboxylate |
| SMILES | COc1ccc(C2CN(C(=O)OCc3ccccn3)CCO2)cc1OC1CCCC1 |
| InChI | InChI=1S/C23H28N2O5/c1-27-20-10-9-17(14-21(20)30-19-7-2-3-8-19)22-15-25(12-13-28-22)23(26)29-16-18-6-4-5-11-24-18/h4-6,9-11,14,19,22H,2-3,7-8,12-13,15-16H2,1H3 |
| InChIKey | GNPDEYGTWLIKJU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |