C18H24ClNO4 — CID 139815958
2-(3-cyclohexyloxy-4-methoxyphenyl)morpholine-4-carbonyl chloride (PubChem CID 139815958) has the molecular formula C18H24ClNO4 and a molecular weight of 353.85 g/mol. Its IUPAC name is 2-(3-cyclohexyloxy-4-methoxyphenyl)morpholine-4-carbonyl chloride.
| Compound Name | 2-(3-cyclohexyloxy-4-methoxyphenyl)morpholine-4-carbonyl chloride |
|---|---|
| PubChem CID | 139815958 |
| Molecular Formula | C18H24ClNO4 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-(3-cyclohexyloxy-4-methoxyphenyl)morpholine-4-carbonyl chloride |
| SMILES | COc1ccc(C2CN(C(=O)Cl)CCO2)cc1OC1CCCCC1 |
| InChI | InChI=1S/C18H24ClNO4/c1-22-15-8-7-13(17-12-20(18(19)21)9-10-23-17)11-16(15)24-14-5-3-2-4-6-14/h7-8,11,14,17H,2-6,9-10,12H2,1H3 |
| InChIKey | BUTMGXWFRBSZTD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|