C28H31NO5 — CID 139815956
naphthalen-2-ylmethyl 2-(3-cyclopentyloxy-4-methoxyphenyl)morpholine-4-carboxylate (PubChem CID 139815956) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is naphthalen-2-ylmethyl 2-(3-cyclopentyloxy-4-methoxyphenyl)morpholine-4-carboxylate.
| Compound Name | naphthalen-2-ylmethyl 2-(3-cyclopentyloxy-4-methoxyphenyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 139815956 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | naphthalen-2-ylmethyl 2-(3-cyclopentyloxy-4-methoxyphenyl)morpholine-4-carboxylate |
| SMILES | COc1ccc(C2CN(C(=O)OCc3ccc4ccccc4c3)CCO2)cc1OC1CCCC1 |
| InChI | InChI=1S/C28H31NO5/c1-31-25-13-12-23(17-26(25)34-24-8-4-5-9-24)27-18-29(14-15-32-27)28(30)33-19-20-10-11-21-6-2-3-7-22(21)16-20/h2-3,6-7,10-13,16-17,24,27H,4-5,8-9,14-15,18-19H2,1H3 |
| InChIKey | RIKBMZRIOUNTKI-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |