C25H27Cl3N4O3 — CID 139820001
2-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(2-hydroxyethoxymethyl)pyrazol-3-yl]-N-piperidin-1-ylacetamide (PubChem CID 139820001) has the molecular formula C25H27Cl3N4O3 and a molecular weight of 537.88 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(2-hydroxyethoxymethyl)pyrazol-3-yl]-N-piperidin-1-ylacetamide.
| Compound Name | 2-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(2-hydroxyethoxymethyl)pyrazol-3-yl]-N-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 139820001 |
| Molecular Formula | C25H27Cl3N4O3 |
| Molecular Weight | 537.88 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(2-hydroxyethoxymethyl)pyrazol-3-yl]-N-piperidin-1-ylacetamide |
| SMILES | O=C(Cc1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1COCCO)NN1CCCCC1 |
| InChI | InChI=1S/C25H27Cl3N4O3/c26-18-6-4-17(5-7-18)25-20(16-35-13-12-33)22(15-24(34)30-31-10-2-1-3-11-31)29-32(25)23-9-8-19(27)14-21(23)28/h4-9,14,33H,1-3,10-13,15-16H2,(H,30,34) |
| InChIKey | OGBKKMXCFKGKFT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.88 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|