C4H9N5O2 — CID 139822017
aziridine-1,2-dicarbohydrazide (PubChem CID 139822017) has the molecular formula C4H9N5O2 and a molecular weight of 159.15 g/mol. Its IUPAC name is aziridine-1,2-dicarbohydrazide.
| Compound Name | aziridine-1,2-dicarbohydrazide |
|---|---|
| PubChem CID | 139822017 |
| Molecular Formula | C4H9N5O2 |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | aziridine-1,2-dicarbohydrazide |
| SMILES | NNC(=O)C1CN1C(=O)NN |
| InChI | InChI=1S/C4H9N5O2/c5-7-3(10)2-1-9(2)4(11)8-6/h2H,1,5-6H2,(H,7,10)(H,8,11) |
| InChIKey | QWPIJPDPAKBGHL-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|