C13H24O4P+ — CID 139864378
hydroxy-[9-(2-methylprop-2-enoyloxy)nonyl]-oxophosphanium (PubChem CID 139864378) has the molecular formula C13H24O4P+ and a molecular weight of 275.30 g/mol. Its IUPAC name is hydroxy-[9-(2-methylprop-2-enoyloxy)nonyl]-oxophosphanium.
| Compound Name | hydroxy-[9-(2-methylprop-2-enoyloxy)nonyl]-oxophosphanium |
|---|---|
| PubChem CID | 139864378 |
| Molecular Formula | C13H24O4P+ |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | hydroxy-[9-(2-methylprop-2-enoyloxy)nonyl]-oxophosphanium |
| SMILES | C=C(C)C(=O)OCCCCCCCCC[P+](=O)O |
| InChI | InChI=1S/C13H23O4P/c1-12(2)13(14)17-10-8-6-4-3-5-7-9-11-18(15)16/h1,3-11H2,2H3/p+1 |
| InChIKey | LWRPJOMGPVTUFC-UHFFFAOYSA-O |
| XLogP | 3.57 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|