C13H21NO3 — CID 139880051
2-(tert-butylamino)-1-(4-hydroxyphenyl)propane-1,3-diol (PubChem CID 139880051) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 2-(tert-butylamino)-1-(4-hydroxyphenyl)propane-1,3-diol.
| Compound Name | 2-(tert-butylamino)-1-(4-hydroxyphenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 139880051 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-(tert-butylamino)-1-(4-hydroxyphenyl)propane-1,3-diol |
| SMILES | CC(C)(C)NC(CO)C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H21NO3/c1-13(2,3)14-11(8-15)12(17)9-4-6-10(16)7-5-9/h4-7,11-12,14-17H,8H2,1-3H3 |
| InChIKey | BOYXNPRTVWANJS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |