C55H105N5O4 — CID 139882757
2-[[[1-[1-[3-(dimethylamino)propyl]piperidin-4-yl]piperidin-4-yl]amino]-[2-[(Z)-octadec-9-enoyl]oxyethyl]amino]ethyl (Z)-octadec-9-enoate (PubChem CID 139882757) has the molecular formula C55H105N5O4 and a molecular weight of 900.48 g/mol. Its IUPAC name is 2-[[[1-[1-[3-(dimethylamino)propyl]piperidin-4-yl]piperidin-4-yl]amino]-[2-[(Z)-octadec-9-enoyl]oxyethyl]amino]ethyl (Z)-octadec-9-enoate.
| Compound Name | 2-[[[1-[1-[3-(dimethylamino)propyl]piperidin-4-yl]piperidin-4-yl]amino]-[2-[(Z)-octadec-9-enoyl]oxyethyl]amino]ethyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 139882757 |
| Molecular Formula | C55H105N5O4 |
| Molecular Weight | 900.48 g/mol |
| Exact Mass | 899.82 |
| IUPAC Name | 2-[[[1-[1-[3-(dimethylamino)propyl]piperidin-4-yl]piperidin-4-yl]amino]-[2-[(Z)-octadec-9-enoyl]oxyethyl]amino]ethyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCN(CCOC(=O)CCCCCCC/C=C\CCCCCCCC)NC1CCN(C2CCN(CCCN(C)C)CC2)CC1 |
| InChI | InChI=1S/C55H105N5O4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36-54(61)63-50-48-60(56-52-38-46-59(47-39-52)53-40-44-58(45-41-53)43-35-42-57(3)4)49-51-64-55(62)37-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,52-53,56H,5-18,23-51H2,1-4H3/b21-19-,22-20- |
| InChIKey | ZPHPQJIKOPOKKK-WRBBJXAJSA-N |
| XLogP | 12.83 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.48 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|