C25H19ClF4 — CID 139884018
7-(4-chloro-3,5-difluorophenyl)-1,9-difluoro-2-pentylphenanthrene (PubChem CID 139884018) has the molecular formula C25H19ClF4 and a molecular weight of 430.87 g/mol. Its IUPAC name is 7-(4-chloro-3,5-difluorophenyl)-1,9-difluoro-2-pentylphenanthrene.
| Compound Name | 7-(4-chloro-3,5-difluorophenyl)-1,9-difluoro-2-pentylphenanthrene |
|---|---|
| PubChem CID | 139884018 |
| Molecular Formula | C25H19ClF4 |
| Molecular Weight | 430.87 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 7-(4-chloro-3,5-difluorophenyl)-1,9-difluoro-2-pentylphenanthrene |
| SMILES | CCCCCc1ccc2c(cc(F)c3cc(-c4cc(F)c(Cl)c(F)c4)ccc32)c1F |
| InChI | InChI=1S/C25H19ClF4/c1-2-3-4-5-14-6-8-18-17-9-7-15(16-11-22(28)24(26)23(29)12-16)10-19(17)21(27)13-20(18)25(14)30/h6-13H,2-5H2,1H3 |
| InChIKey | VQEBKGKALBFBHX-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.87 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|