C25H17F7O — CID 139883815
2-butyl-7-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-1,9-difluorophenanthrene (PubChem CID 139883815) has the molecular formula C25H17F7O and a molecular weight of 466.40 g/mol. Its IUPAC name is 2-butyl-7-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-1,9-difluorophenanthrene.
| Compound Name | 2-butyl-7-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-1,9-difluorophenanthrene |
|---|---|
| PubChem CID | 139883815 |
| Molecular Formula | C25H17F7O |
| Molecular Weight | 466.40 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 2-butyl-7-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-1,9-difluorophenanthrene |
| SMILES | CCCCc1ccc2c(cc(F)c3cc(-c4cc(F)c(OC(F)(F)F)c(F)c4)ccc32)c1F |
| InChI | InChI=1S/C25H17F7O/c1-2-3-4-13-5-7-17-16-8-6-14(9-18(16)20(26)12-19(17)23(13)29)15-10-21(27)24(22(28)11-15)33-25(30,31)32/h5-12H,2-4H2,1H3 |
| InChIKey | NVRWUGWLXBNWPU-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.40 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|