C24H17F5O — CID 22045652
1,9-difluoro-2-propyl-7-[4-(trifluoromethoxy)phenyl]phenanthrene (PubChem CID 22045652) has the molecular formula C24H17F5O and a molecular weight of 416.39 g/mol. Its IUPAC name is 1,9-difluoro-2-propyl-7-[4-(trifluoromethoxy)phenyl]phenanthrene.
| Compound Name | 1,9-difluoro-2-propyl-7-[4-(trifluoromethoxy)phenyl]phenanthrene |
|---|---|
| PubChem CID | 22045652 |
| Molecular Formula | C24H17F5O |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 1,9-difluoro-2-propyl-7-[4-(trifluoromethoxy)phenyl]phenanthrene |
| SMILES | CCCc1ccc2c(cc(F)c3cc(-c4ccc(OC(F)(F)F)cc4)ccc32)c1F |
| InChI | InChI=1S/C24H17F5O/c1-2-3-15-6-10-19-18-11-7-16(12-20(18)22(25)13-21(19)23(15)26)14-4-8-17(9-5-14)30-24(27,28)29/h4-13H,2-3H2,1H3 |
| InChIKey | DYGKTNRBOSESRC-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|