C25H18F6 — CID 139884213
2-butyl-1,9-difluoro-7-[3-fluoro-4-(trifluoromethyl)phenyl]phenanthrene (PubChem CID 139884213) has the molecular formula C25H18F6 and a molecular weight of 432.41 g/mol. Its IUPAC name is 2-butyl-1,9-difluoro-7-[3-fluoro-4-(trifluoromethyl)phenyl]phenanthrene.
| Compound Name | 2-butyl-1,9-difluoro-7-[3-fluoro-4-(trifluoromethyl)phenyl]phenanthrene |
|---|---|
| PubChem CID | 139884213 |
| Molecular Formula | C25H18F6 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 2-butyl-1,9-difluoro-7-[3-fluoro-4-(trifluoromethyl)phenyl]phenanthrene |
| SMILES | CCCCc1ccc2c(cc(F)c3cc(-c4ccc(C(F)(F)F)c(F)c4)ccc32)c1F |
| InChI | InChI=1S/C25H18F6/c1-2-3-4-14-5-8-18-17-9-6-15(11-19(17)22(26)13-20(18)24(14)28)16-7-10-21(23(27)12-16)25(29,30)31/h5-13H,2-4H2,1H3 |
| InChIKey | UEYPTESACNVDRN-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|